About ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene
ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene (PubChem CID 161269952) has the molecular formula C18H26O3S
and a molecular weight of 322.47 g/mol. Its IUPAC name is ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene.
Molecular Properties
| Compound Name | ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene |
| PubChem CID | 161269952 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene |
| SMILES | C.CCOCc1ccccc1.Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C9H12O.C8H10O2S.CH4/c1-2-10-8-9-6-4-3-5-7-9;1-7-3-5-8(6-4-7)11(2,9)10;/h3-7H,2,8H2,1H3;3-6H,1-2H3;1H4 |
| InChIKey | VDRHEIBZNBNZBD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene?
The IUPAC name of ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene (CID 161269952) is ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene.
What is the SMILES notation for ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene?
The canonical SMILES for ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene is C.CCOCc1ccccc1.Cc1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene?
The InChIKey is VDRHEIBZNBNZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C8H10O2S.CH4/c1-2-10-8-9-6-4-3-5-7-9;1-7-3-5-8(6-4-7)11(2,9)10;/h3-7H,2,8H2,1H3;3-6H,1-2H3;1H4.
What are the key properties of ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene?
ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene has a molecular weight of 322.47 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethylbenzene;methane;1-methyl-4-methylsulfonylbenzene is sourced from PubChem (CID 161269952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).