C13H19NO3S — CID 102091018
2-[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethanol (PubChem CID 102091018) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethanol.
| Compound Name | 2-[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethanol |
|---|---|
| PubChem CID | 102091018 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethanol |
| SMILES | CC[C@@H]1[C@@H](CCO)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-3-12-13(8-9-15)14(12)18(16,17)11-6-4-10(2)5-7-11/h4-7,12-13,15H,3,8-9H2,1-2H3/t12-,13-,14?/m1/s1 |
| InChIKey | HMUYNCZPPZHPNI-ZFXTZCCVSA-N |
| XLogP | 1.53 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|