C15H24NO5PS — CID 15473727
(2S,3R)-2-diethoxyphosphoryl-3-ethyl-1-(4-methylphenyl)sulfonylaziridine (PubChem CID 15473727) has the molecular formula C15H24NO5PS and a molecular weight of 361.40 g/mol. Its IUPAC name is (2S,3R)-2-diethoxyphosphoryl-3-ethyl-1-(4-methylphenyl)sulfonylaziridine.
| Compound Name | (2S,3R)-2-diethoxyphosphoryl-3-ethyl-1-(4-methylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 15473727 |
| Molecular Formula | C15H24NO5PS |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2S,3R)-2-diethoxyphosphoryl-3-ethyl-1-(4-methylphenyl)sulfonylaziridine |
| SMILES | CCOP(=O)(OCC)[C@H]1[C@@H](CC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H24NO5PS/c1-5-14-15(22(17,20-6-2)21-7-3)16(14)23(18,19)13-10-8-12(4)9-11-13/h8-11,14-15H,5-7H2,1-4H3/t14-,15+,16?/m1/s1 |
| InChIKey | QEEMISWUHLPCEE-YSPPHNQVSA-N |
| XLogP | 3.37 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|