C23H43N3O8P2S — CID 22889149
1,4-bis(diethoxyphosphorylmethyl)-7-(4-methylphenyl)sulfonyl-1,4,7-triazonane (PubChem CID 22889149) has the molecular formula C23H43N3O8P2S and a molecular weight of 583.63 g/mol. Its IUPAC name is 1,4-bis(diethoxyphosphorylmethyl)-7-(4-methylphenyl)sulfonyl-1,4,7-triazonane.
| Compound Name | 1,4-bis(diethoxyphosphorylmethyl)-7-(4-methylphenyl)sulfonyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 22889149 |
| Molecular Formula | C23H43N3O8P2S |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 1,4-bis(diethoxyphosphorylmethyl)-7-(4-methylphenyl)sulfonyl-1,4,7-triazonane |
| SMILES | CCOP(=O)(CN1CCN(CP(=O)(OCC)OCC)CCN(S(=O)(=O)c2ccc(C)cc2)CC1)OCC |
| InChI | InChI=1S/C23H43N3O8P2S/c1-6-31-35(27,32-7-2)20-24-14-15-25(21-36(28,33-8-3)34-9-4)17-19-26(18-16-24)37(29,30)23-12-10-22(5)11-13-23/h10-13H,6-9,14-21H2,1-5H3 |
| InChIKey | GNMJMEWAFAQTRY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|