C21H28N2O2S — CID 113076386
1-(2,6-diethylphenyl)-4-(4-methylphenyl)sulfonylpiperazine (PubChem CID 113076386) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-4-(4-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2,6-diethylphenyl)-4-(4-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 113076386 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-(2,6-diethylphenyl)-4-(4-methylphenyl)sulfonylpiperazine |
| SMILES | CCc1cccc(CC)c1N1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C21H28N2O2S/c1-4-18-7-6-8-19(5-2)21(18)22-13-15-23(16-14-22)26(24,25)20-11-9-17(3)10-12-20/h6-12H,4-5,13-16H2,1-3H3 |
| InChIKey | IDVADKTYMMJBLY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |