C21H29N3O5S2 — CID 4830106
N-[2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 4830106) has the molecular formula C21H29N3O5S2 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4830106 |
| Molecular Formula | C21H29N3O5S2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(CCNS(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O5S2/c1-3-29-19-6-10-21(11-7-19)31(27,28)24-16-14-23(15-17-24)13-12-22-30(25,26)20-8-4-18(2)5-9-20/h4-11,22H,3,12-17H2,1-2H3 |
| InChIKey | CTQGQBDXJCHYJB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |