C13H21N3O4S2 — CID 71192302
1-(4-methylphenyl)sulfonyl-4-[2-(sulfinoamino)ethyl]piperazine (PubChem CID 71192302) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-[2-(sulfinoamino)ethyl]piperazine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-[2-(sulfinoamino)ethyl]piperazine |
|---|---|
| PubChem CID | 71192302 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-[2-(sulfinoamino)ethyl]piperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CCNS(=O)O)CC2)cc1 |
| InChI | InChI=1S/C13H21N3O4S2/c1-12-2-4-13(5-3-12)22(19,20)16-10-8-15(9-11-16)7-6-14-21(17)18/h2-5,14H,6-11H2,1H3,(H,17,18) |
| InChIKey | JWUTVDBZQBLUMC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|