C34H41N5O6S3 — CID 71652391
N-[2-[3,9-bis-(4-methylphenyl)sulfonyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 71652391) has the molecular formula C34H41N5O6S3 and a molecular weight of 711.93 g/mol. Its IUPAC name is N-[2-[3,9-bis-(4-methylphenyl)sulfonyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[3,9-bis-(4-methylphenyl)sulfonyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71652391 |
| Molecular Formula | C34H41N5O6S3 |
| Molecular Weight | 711.93 g/mol |
| Exact Mass | 711.22 |
| IUPAC Name | N-[2-[3,9-bis-(4-methylphenyl)sulfonyl-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCN2CCN(S(=O)(=O)c3ccc(C)cc3)Cc3cccc(n3)CN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C34H41N5O6S3/c1-27-7-13-32(14-8-27)46(40,41)35-19-20-37-21-23-38(47(42,43)33-15-9-28(2)10-16-33)25-30-5-4-6-31(36-30)26-39(24-22-37)48(44,45)34-17-11-29(3)12-18-34/h4-18,35H,19-26H2,1-3H3 |
| InChIKey | FPHWYZPHSQWYHX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.93 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |