C31H35N5O4S2 — CID 162341949
11-methyl-8,14-bis-(4-methylphenyl)sulfonyl-8,11,14,20,21-pentazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene (PubChem CID 162341949) has the molecular formula C31H35N5O4S2 and a molecular weight of 605.79 g/mol. Its IUPAC name is 11-methyl-8,14-bis-(4-methylphenyl)sulfonyl-8,11,14,20,21-pentazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene.
| Compound Name | 11-methyl-8,14-bis-(4-methylphenyl)sulfonyl-8,11,14,20,21-pentazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene |
|---|---|
| PubChem CID | 162341949 |
| Molecular Formula | C31H35N5O4S2 |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 11-methyl-8,14-bis-(4-methylphenyl)sulfonyl-8,11,14,20,21-pentazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C)CCN(S(=O)(=O)c3ccc(C)cc3)Cc3cccc(n3)-c3cccc(n3)C2)cc1 |
| InChI | InChI=1S/C31H35N5O4S2/c1-24-10-14-28(15-11-24)41(37,38)35-20-18-34(3)19-21-36(42(39,40)29-16-12-25(2)13-17-29)23-27-7-5-9-31(33-27)30-8-4-6-26(22-35)32-30/h4-17H,18-23H2,1-3H3 |
| InChIKey | KSMARDKCKCGPHB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 103.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |