C19H22NO5PS — CID 15273064
2-(benzenesulfonyl)-1-diethoxyphosphoryl-1H-isoquinoline (PubChem CID 15273064) has the molecular formula C19H22NO5PS and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-diethoxyphosphoryl-1H-isoquinoline.
| Compound Name | 2-(benzenesulfonyl)-1-diethoxyphosphoryl-1H-isoquinoline |
|---|---|
| PubChem CID | 15273064 |
| Molecular Formula | C19H22NO5PS |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-(benzenesulfonyl)-1-diethoxyphosphoryl-1H-isoquinoline |
| SMILES | CCOP(=O)(OCC)C1c2ccccc2C=CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22NO5PS/c1-3-24-26(21,25-4-2)19-18-13-9-8-10-16(18)14-15-20(19)27(22,23)17-11-6-5-7-12-17/h5-15,19H,3-4H2,1-2H3 |
| InChIKey | KWCGBJPLXBDPAH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|