C17H29NO4SSi — CID 59051238
[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol (PubChem CID 59051238) has the molecular formula C17H29NO4SSi and a molecular weight of 371.58 g/mol. Its IUPAC name is [(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol |
|---|---|
| PubChem CID | 59051238 |
| Molecular Formula | C17H29NO4SSi |
| Molecular Weight | 371.58 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](CO)[C@@H]2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29NO4SSi/c1-13-7-9-14(10-8-13)23(20,21)18-15(11-19)16(18)12-22-24(5,6)17(2,3)4/h7-10,15-16,19H,11-12H2,1-6H3/t15-,16-,18?/m0/s1 |
| InChIKey | WEKZGRATPGFOOO-MZQXSQAVSA-N |
| XLogP | 2.75 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|