C44H53NO4SSi2 — CID 59052953
tert-butyl-[[(2R,4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylazetidin-2-yl]methoxy]-diphenylsilane (PubChem CID 59052953) has the molecular formula C44H53NO4SSi2 and a molecular weight of 748.15 g/mol. Its IUPAC name is tert-butyl-[[(2R,4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylazetidin-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylazetidin-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 59052953 |
| Molecular Formula | C44H53NO4SSi2 |
| Molecular Weight | 748.15 g/mol |
| Exact Mass | 747.32 |
| IUPAC Name | tert-butyl-[[(2R,4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylazetidin-2-yl]methoxy]-diphenylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C44H53NO4SSi2/c1-35-28-30-38(31-29-35)50(46,47)45-36(33-48-51(43(2,3)4,39-20-12-8-13-21-39)40-22-14-9-15-23-40)32-37(45)34-49-52(44(5,6)7,41-24-16-10-17-25-41)42-26-18-11-19-27-42/h8-31,36-37H,32-34H2,1-7H3/t36-,37+ |
| InChIKey | CBNCDFGNSQAONB-JXLNJXQWSA-N |
| XLogP | 7.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.15 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|