C35H49NO4SSi — CID 54762861
4-[(2S,3R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-1-ol (PubChem CID 54762861) has the molecular formula C35H49NO4SSi and a molecular weight of 607.93 g/mol. Its IUPAC name is 4-[(2S,3R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-1-ol.
| Compound Name | 4-[(2S,3R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 54762861 |
| Molecular Formula | C35H49NO4SSi |
| Molecular Weight | 607.93 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | 4-[(2S,3R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methyl-1-(4-methylphenyl)sulfonylpiperidin-2-yl]butan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@@H](C)[C@@H]2CCCCO)cc1 |
| InChI | InChI=1S/C35H49NO4SSi/c1-28-19-23-31(24-20-28)41(38,39)36-30(22-21-29(2)34(36)18-12-13-26-37)25-27-40-42(35(3,4)5,32-14-8-6-9-15-32)33-16-10-7-11-17-33/h6-11,14-17,19-20,23-24,29-30,34,37H,12-13,18,21-22,25-27H2,1-5H3/t29-,30+,34+/m1/s1 |
| InChIKey | OOTPOLYKSVQLEE-CRBXJKDESA-N |
| XLogP | 6.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.93 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|