C29H32INO5SSi — CID 56651489
(2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-4-iodo-1-(4-methylphenyl)sulfonyl-2,6-dihydropyridin-3-one (PubChem CID 56651489) has the molecular formula C29H32INO5SSi and a molecular weight of 661.63 g/mol. Its IUPAC name is (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-4-iodo-1-(4-methylphenyl)sulfonyl-2,6-dihydropyridin-3-one.
| Compound Name | (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-4-iodo-1-(4-methylphenyl)sulfonyl-2,6-dihydropyridin-3-one |
|---|---|
| PubChem CID | 56651489 |
| Molecular Formula | C29H32INO5SSi |
| Molecular Weight | 661.63 g/mol |
| Exact Mass | 661.08 |
| IUPAC Name | (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-4-iodo-1-(4-methylphenyl)sulfonyl-2,6-dihydropyridin-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](O)C=C(I)C(=O)[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H32INO5SSi/c1-21-15-17-22(18-16-21)37(34,35)31-26(28(33)25(30)19-27(31)32)20-36-38(29(2,3)4,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-19,26-27,32H,20H2,1-4H3/t26-,27-/m0/s1 |
| InChIKey | CQADCWMRLIGVQC-SVBPBHIXSA-N |
| XLogP | 4.15 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|