C36H42N2O5S2Si — CID 11204651
(2S,5S,6R)-5-(4-aminophenyl)sulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-1-(4-methylphenyl)sulfonylpiperidin-3-one (PubChem CID 11204651) has the molecular formula C36H42N2O5S2Si and a molecular weight of 674.96 g/mol. Its IUPAC name is (2S,5S,6R)-5-(4-aminophenyl)sulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-1-(4-methylphenyl)sulfonylpiperidin-3-one.
| Compound Name | (2S,5S,6R)-5-(4-aminophenyl)sulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-1-(4-methylphenyl)sulfonylpiperidin-3-one |
|---|---|
| PubChem CID | 11204651 |
| Molecular Formula | C36H42N2O5S2Si |
| Molecular Weight | 674.96 g/mol |
| Exact Mass | 674.23 |
| IUPAC Name | (2S,5S,6R)-5-(4-aminophenyl)sulfanyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-1-(4-methylphenyl)sulfonylpiperidin-3-one |
| SMILES | CO[C@@H]1[C@@H](Sc2ccc(N)cc2)CC(=O)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C36H42N2O5S2Si/c1-26-16-22-29(23-17-26)45(40,41)38-32(33(39)24-34(35(38)42-5)44-28-20-18-27(37)19-21-28)25-43-46(36(2,3)4,30-12-8-6-9-13-30)31-14-10-7-11-15-31/h6-23,32,34-35H,24-25,37H2,1-5H3/t32-,34-,35+/m0/s1 |
| InChIKey | LQCIVUUTJLKWPT-SEFMXRCBSA-N |
| XLogP | 5.62 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.96 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|