C31H39NO4SSi — CID 11763350
[(6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methylphenyl)sulfonyl-5-azaspiro[2.4]heptan-2-yl]methanol (PubChem CID 11763350) has the molecular formula C31H39NO4SSi and a molecular weight of 549.81 g/mol. Its IUPAC name is [(6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methylphenyl)sulfonyl-5-azaspiro[2.4]heptan-2-yl]methanol.
| Compound Name | [(6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methylphenyl)sulfonyl-5-azaspiro[2.4]heptan-2-yl]methanol |
|---|---|
| PubChem CID | 11763350 |
| Molecular Formula | C31H39NO4SSi |
| Molecular Weight | 549.81 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | [(6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methylphenyl)sulfonyl-5-azaspiro[2.4]heptan-2-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3(CC3CO)C[C@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H39NO4SSi/c1-24-15-17-27(18-16-24)37(34,35)32-23-31(19-25(31)21-33)20-26(32)22-36-38(30(2,3)4,28-11-7-5-8-12-28)29-13-9-6-10-14-29/h5-18,25-26,33H,19-23H2,1-4H3/t25?,26-,31?/m0/s1 |
| InChIKey | IFEKFQVNRWRBPT-GFKDGEDWSA-N |
| XLogP | 4.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.81 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|