C31H38INO4SSi — CID 12964134
[(2S,3aS,5S,6aR)-2-(iodomethyl)-6-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]pyrrol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 12964134) has the molecular formula C31H38INO4SSi and a molecular weight of 675.71 g/mol. Its IUPAC name is [(2S,3aS,5S,6aR)-2-(iodomethyl)-6-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]pyrrol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3aS,5S,6aR)-2-(iodomethyl)-6-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]pyrrol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 12964134 |
| Molecular Formula | C31H38INO4SSi |
| Molecular Weight | 675.71 g/mol |
| Exact Mass | 675.13 |
| IUPAC Name | [(2S,3aS,5S,6aR)-2-(iodomethyl)-6-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]pyrrol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]3C[C@@H](CI)O[C@H]32)cc1 |
| InChI | InChI=1S/C31H38INO4SSi/c1-23-15-17-27(18-16-23)38(34,35)33-25(19-24-20-26(21-32)37-30(24)33)22-36-39(31(2,3)4,28-11-7-5-8-12-28)29-13-9-6-10-14-29/h5-18,24-26,30H,19-22H2,1-4H3/t24-,25-,26-,30+/m0/s1 |
| InChIKey | NOUQZWVMWXIGMG-VWDBNSKXSA-N |
| XLogP | 5.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|