C34H41N3O5SSi — CID 10651650
1-[(3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-5-ethylpyrimidine-2,4-dione (PubChem CID 10651650) has the molecular formula C34H41N3O5SSi and a molecular weight of 631.87 g/mol. Its IUPAC name is 1-[(3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-[(3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10651650 |
| Molecular Formula | C34H41N3O5SSi |
| Molecular Weight | 631.87 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | 1-[(3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1cn([C@H]2C[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)N(S(=O)(=O)c3ccc(C)cc3)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H41N3O5SSi/c1-6-26-22-36(33(39)35-32(26)38)27-21-28(37(23-27)43(40,41)29-19-17-25(2)18-20-29)24-42-44(34(3,4)5,30-13-9-7-10-14-30)31-15-11-8-12-16-31/h7-20,22,27-28H,6,21,23-24H2,1-5H3,(H,35,38,39)/t27-,28-/m0/s1 |
| InChIKey | PSMNYVYWYHDGBM-NSOVKSMOSA-N |
| XLogP | 3.99 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|