C18H25NO5S — CID 10808987
ethyl (2S,3S,4R,6S)-6-ethenyl-4-hydroxy-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 10808987) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is ethyl (2S,3S,4R,6S)-6-ethenyl-4-hydroxy-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl (2S,3S,4R,6S)-6-ethenyl-4-hydroxy-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 10808987 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl (2S,3S,4R,6S)-6-ethenyl-4-hydroxy-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | C=C[C@@H]1C[C@@H](O)[C@@H](C)[C@@H](C(=O)OCC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO5S/c1-5-14-11-16(20)13(4)17(18(21)24-6-2)19(14)25(22,23)15-9-7-12(3)8-10-15/h5,7-10,13-14,16-17,20H,1,6,11H2,2-4H3/t13-,14-,16-,17+/m1/s1 |
| InChIKey | DCXWIXFLRFQKJL-SRABZTEZSA-N |
| XLogP | 1.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|