C22H31NO5S — CID 11304730
ethyl (2R,3R,3aR,6aR)-1-(4-methylphenyl)sulfonyl-3-pentanoyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 11304730) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is ethyl (2R,3R,3aR,6aR)-1-(4-methylphenyl)sulfonyl-3-pentanoyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2R,3R,3aR,6aR)-1-(4-methylphenyl)sulfonyl-3-pentanoyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 11304730 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | ethyl (2R,3R,3aR,6aR)-1-(4-methylphenyl)sulfonyl-3-pentanoyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCCCC(=O)[C@@H]1[C@H]2CCC[C@H]2N(S(=O)(=O)c2ccc(C)cc2)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C22H31NO5S/c1-4-6-10-19(24)20-17-8-7-9-18(17)23(21(20)22(25)28-5-2)29(26,27)16-13-11-15(3)12-14-16/h11-14,17-18,20-21H,4-10H2,1-3H3/t17-,18+,20-,21+/m0/s1 |
| InChIKey | AINJNCMPYPGWEZ-IZZBFERCSA-N |
| XLogP | 3.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |