C14H22F3NO3S — CID 11484616
1-[(2R,3S,3aR,6aR)-2-methyl-1-(trifluoromethylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]pentan-1-one (PubChem CID 11484616) has the molecular formula C14H22F3NO3S and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-[(2R,3S,3aR,6aR)-2-methyl-1-(trifluoromethylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]pentan-1-one.
| Compound Name | 1-[(2R,3S,3aR,6aR)-2-methyl-1-(trifluoromethylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 11484616 |
| Molecular Formula | C14H22F3NO3S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-[(2R,3S,3aR,6aR)-2-methyl-1-(trifluoromethylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-yl]pentan-1-one |
| SMILES | CCCCC(=O)[C@H]1[C@H]2CCC[C@H]2N(S(=O)(=O)C(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C14H22F3NO3S/c1-3-4-8-12(19)13-9(2)18(11-7-5-6-10(11)13)22(20,21)14(15,16)17/h9-11,13H,3-8H2,1-2H3/t9-,10+,11-,13-/m1/s1 |
| InChIKey | VLLDRXYPIFRNHF-LSCVPOLPSA-N |
| XLogP | 3.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |