C18H24N2O7S — CID 4987233
diethyl 2-[[3-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carbonyl]amino]propanedioate (PubChem CID 4987233) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is diethyl 2-[[3-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carbonyl]amino]propanedioate.
| Compound Name | diethyl 2-[[3-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carbonyl]amino]propanedioate |
|---|---|
| PubChem CID | 4987233 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | diethyl 2-[[3-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carbonyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)C1C(C)N1S(=O)(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C18H24N2O7S/c1-5-26-17(22)14(18(23)27-6-2)19-16(21)15-12(4)20(15)28(24,25)13-9-7-11(3)8-10-13/h7-10,12,14-15H,5-6H2,1-4H3,(H,19,21) |
| InChIKey | JUHMAJDJJVWEOZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|