C15H22N2O5S — CID 11221560
(2S,3R)-N,N-dimethoxy-1-(4-methylphenyl)sulfonyl-3-propylaziridine-2-carboxamide (PubChem CID 11221560) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is (2S,3R)-N,N-dimethoxy-1-(4-methylphenyl)sulfonyl-3-propylaziridine-2-carboxamide.
| Compound Name | (2S,3R)-N,N-dimethoxy-1-(4-methylphenyl)sulfonyl-3-propylaziridine-2-carboxamide |
|---|---|
| PubChem CID | 11221560 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (2S,3R)-N,N-dimethoxy-1-(4-methylphenyl)sulfonyl-3-propylaziridine-2-carboxamide |
| SMILES | CCC[C@@H]1[C@@H](C(=O)N(OC)OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22N2O5S/c1-5-6-13-14(15(18)17(21-3)22-4)16(13)23(19,20)12-9-7-11(2)8-10-12/h7-10,13-14H,5-6H2,1-4H3/t13-,14+,16?/m1/s1 |
| InChIKey | ZZMGRCSENIIEIY-CNYCQXTOSA-N |
| XLogP | 1.49 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|