C16H22INO4S — CID 15408066
methyl (2S,4R,5S)-4-iodo-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-2-carboxylate (PubChem CID 15408066) has the molecular formula C16H22INO4S and a molecular weight of 451.33 g/mol. Its IUPAC name is methyl (2S,4R,5S)-4-iodo-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R,5S)-4-iodo-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15408066 |
| Molecular Formula | C16H22INO4S |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | methyl (2S,4R,5S)-4-iodo-1-(4-methylphenyl)sulfonyl-5-propylpyrrolidine-2-carboxylate |
| SMILES | CCC[C@H]1[C@H](I)C[C@@H](C(=O)OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22INO4S/c1-4-5-14-13(17)10-15(16(19)22-3)18(14)23(20,21)12-8-6-11(2)7-9-12/h6-9,13-15H,4-5,10H2,1-3H3/t13-,14+,15+/m1/s1 |
| InChIKey | LTJFUUYXFFRSNY-ILXRZTDVSA-N |
| XLogP | 2.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|