C17H19NO6S — CID 135022396
dimethyl (2S,4R,5R)-5-ethynyl-1-(4-methylphenyl)sulfonylpyrrolidine-2,4-dicarboxylate (PubChem CID 135022396) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is dimethyl (2S,4R,5R)-5-ethynyl-1-(4-methylphenyl)sulfonylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2S,4R,5R)-5-ethynyl-1-(4-methylphenyl)sulfonylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 135022396 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | dimethyl (2S,4R,5R)-5-ethynyl-1-(4-methylphenyl)sulfonylpyrrolidine-2,4-dicarboxylate |
| SMILES | C#C[C@H]1[C@H](C(=O)OC)C[C@@H](C(=O)OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19NO6S/c1-5-14-13(16(19)23-3)10-15(17(20)24-4)18(14)25(21,22)12-8-6-11(2)7-9-12/h1,6-9,13-15H,10H2,2-4H3/t13-,14+,15+/m1/s1 |
| InChIKey | UZACROIFWXEYSN-ILXRZTDVSA-N |
| XLogP | 0.72 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|