C42H58N2O16S2 — CID 139092974
4-O-ethyl 2-O-methyl (2R,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2,4-dicarboxylate (PubChem CID 139092974) has the molecular formula C42H58N2O16S2 and a molecular weight of 911.06 g/mol. Its IUPAC name is 4-O-ethyl 2-O-methyl (2R,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-methyl (2R,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 139092974 |
| Molecular Formula | C42H58N2O16S2 |
| Molecular Weight | 911.06 g/mol |
| Exact Mass | 910.32 |
| IUPAC Name | 4-O-ethyl 2-O-methyl (2R,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](C(=O)OC)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1[C@H]1COC(C)(C)O1.CCOC(=O)[C@@H]1C[C@H](C(=O)OC)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/2C21H29NO8S/c2*1-6-28-19(23)15-11-16(20(24)27-5)22(18(15)17-12-29-21(3,4)30-17)31(25,26)14-9-7-13(2)8-10-14/h2*7-10,15-18H,6,11-12H2,1-5H3/t2*15-,16-,17-,18+/m11/s1 |
| InChIKey | QHFFGUFBMQUISU-ZBNSNGKGSA-N |
| XLogP | 3.26 |
| TPSA | 216.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.06 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|