C18H23NO6S — CID 10861848
methyl (1S,2S,6R,7S,9S)-4,4-dimethyl-8-(4-methylphenyl)sulfonyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-9-carboxylate (PubChem CID 10861848) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl (1S,2S,6R,7S,9S)-4,4-dimethyl-8-(4-methylphenyl)sulfonyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-9-carboxylate.
| Compound Name | methyl (1S,2S,6R,7S,9S)-4,4-dimethyl-8-(4-methylphenyl)sulfonyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-9-carboxylate |
|---|---|
| PubChem CID | 10861848 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | methyl (1S,2S,6R,7S,9S)-4,4-dimethyl-8-(4-methylphenyl)sulfonyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-9-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C[C@@H]([C@H]3OC(C)(C)O[C@@H]23)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO6S/c1-10-5-7-11(8-6-10)26(21,22)19-13-9-12(14(19)17(20)23-4)15-16(13)25-18(2,3)24-15/h5-8,12-16H,9H2,1-4H3/t12-,13-,14-,15-,16+/m0/s1 |
| InChIKey | IICAWQGJUXNVHC-UVPYHEFZSA-N |
| XLogP | 1.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |