C21H19NO4S — CID 101217309
methyl (2S,3R)-1-(4-methylphenyl)sulfonyl-3-naphthalen-1-ylaziridine-2-carboxylate (PubChem CID 101217309) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl (2S,3R)-1-(4-methylphenyl)sulfonyl-3-naphthalen-1-ylaziridine-2-carboxylate.
| Compound Name | methyl (2S,3R)-1-(4-methylphenyl)sulfonyl-3-naphthalen-1-ylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 101217309 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl (2S,3R)-1-(4-methylphenyl)sulfonyl-3-naphthalen-1-ylaziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2cccc3ccccc23)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H19NO4S/c1-14-10-12-16(13-11-14)27(24,25)22-19(20(22)21(23)26-2)18-9-5-7-15-6-3-4-8-17(15)18/h3-13,19-20H,1-2H3/t19-,20+,22?/m1/s1 |
| InChIKey | LZUSGAWANXZPSX-MFCMXAAESA-N |
| XLogP | 3.44 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|