C28H25NO5S — CID 134963273
methyl 2-[(1S,3S)-3-(2-hydroxynaphthalen-1-yl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-1-yl]acetate (PubChem CID 134963273) has the molecular formula C28H25NO5S and a molecular weight of 487.58 g/mol. Its IUPAC name is methyl 2-[(1S,3S)-3-(2-hydroxynaphthalen-1-yl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-1-yl]acetate.
| Compound Name | methyl 2-[(1S,3S)-3-(2-hydroxynaphthalen-1-yl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-1-yl]acetate |
|---|---|
| PubChem CID | 134963273 |
| Molecular Formula | C28H25NO5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | methyl 2-[(1S,3S)-3-(2-hydroxynaphthalen-1-yl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-1-yl]acetate |
| SMILES | COC(=O)C[C@H]1c2ccccc2[C@@H](c2c(O)ccc3ccccc23)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H25NO5S/c1-18-11-14-20(15-12-18)35(32,33)29-24(17-26(31)34-2)22-9-5-6-10-23(22)28(29)27-21-8-4-3-7-19(21)13-16-25(27)30/h3-16,24,28,30H,17H2,1-2H3/t24-,28-/m0/s1 |
| InChIKey | XCFQDZIZALGIOG-CUBQBAPOSA-N |
| XLogP | 5.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|