C23H21NO4S — CID 67435881
methyl 2-[5-(4-methylphenyl)sulfonyl-6H-phenanthridin-6-yl]acetate (PubChem CID 67435881) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is methyl 2-[5-(4-methylphenyl)sulfonyl-6H-phenanthridin-6-yl]acetate.
| Compound Name | methyl 2-[5-(4-methylphenyl)sulfonyl-6H-phenanthridin-6-yl]acetate |
|---|---|
| PubChem CID | 67435881 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 2-[5-(4-methylphenyl)sulfonyl-6H-phenanthridin-6-yl]acetate |
| SMILES | COC(=O)CC1c2ccccc2-c2ccccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H21NO4S/c1-16-11-13-17(14-12-16)29(26,27)24-21-10-6-5-8-19(21)18-7-3-4-9-20(18)22(24)15-23(25)28-2/h3-14,22H,15H2,1-2H3 |
| InChIKey | ZTSGNHVJKMDZGL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |