C21H23NO4S — CID 11501904
methyl 4-[3-methylidene-1-(4-methylphenyl)sulfonyl-2H-indol-2-yl]butanoate (PubChem CID 11501904) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is methyl 4-[3-methylidene-1-(4-methylphenyl)sulfonyl-2H-indol-2-yl]butanoate.
| Compound Name | methyl 4-[3-methylidene-1-(4-methylphenyl)sulfonyl-2H-indol-2-yl]butanoate |
|---|---|
| PubChem CID | 11501904 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 4-[3-methylidene-1-(4-methylphenyl)sulfonyl-2H-indol-2-yl]butanoate |
| SMILES | C=C1c2ccccc2N(S(=O)(=O)c2ccc(C)cc2)C1CCCC(=O)OC |
| InChI | InChI=1S/C21H23NO4S/c1-15-11-13-17(14-12-15)27(24,25)22-19(9-6-10-21(23)26-3)16(2)18-7-4-5-8-20(18)22/h4-5,7-8,11-14,19H,2,6,9-10H2,1,3H3 |
| InChIKey | HPDCVLRFAGIHRX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |