C26H26N2O6S — CID 139199800
ethyl 3-[(3aS,4R,10aS,10bS)-10-(4-methylphenyl)sulfonyl-1,3-dioxo-3a,4,10a,10b-tetrahydropyrrolo[3,4-a]carbazol-4-yl]propanoate (PubChem CID 139199800) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is ethyl 3-[(3aS,4R,10aS,10bS)-10-(4-methylphenyl)sulfonyl-1,3-dioxo-3a,4,10a,10b-tetrahydropyrrolo[3,4-a]carbazol-4-yl]propanoate.
| Compound Name | ethyl 3-[(3aS,4R,10aS,10bS)-10-(4-methylphenyl)sulfonyl-1,3-dioxo-3a,4,10a,10b-tetrahydropyrrolo[3,4-a]carbazol-4-yl]propanoate |
|---|---|
| PubChem CID | 139199800 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | ethyl 3-[(3aS,4R,10aS,10bS)-10-(4-methylphenyl)sulfonyl-1,3-dioxo-3a,4,10a,10b-tetrahydropyrrolo[3,4-a]carbazol-4-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1C=C2c3ccccc3N(S(=O)(=O)c3ccc(C)cc3)[C@H]2[C@H]2C(=O)NC(=O)[C@H]21 |
| InChI | InChI=1S/C26H26N2O6S/c1-3-34-21(29)13-10-16-14-19-18-6-4-5-7-20(18)28(24(19)23-22(16)25(30)27-26(23)31)35(32,33)17-11-8-15(2)9-12-17/h4-9,11-12,14,16,22-24H,3,10,13H2,1-2H3,(H,27,30,31)/t16-,22+,23+,24-/m1/s1 |
| InChIKey | VDQCWCHPNXREPP-KEVBDDOHSA-N |
| XLogP | 2.82 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|