C24H28BrNO5S — CID 102194220
tert-butyl (2R,3R)-3-bromo-1-(4-methylphenyl)sulfonyl-4-oxo-2-propyl-2H-quinoline-3-carboxylate (PubChem CID 102194220) has the molecular formula C24H28BrNO5S and a molecular weight of 522.46 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-bromo-1-(4-methylphenyl)sulfonyl-4-oxo-2-propyl-2H-quinoline-3-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-bromo-1-(4-methylphenyl)sulfonyl-4-oxo-2-propyl-2H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 102194220 |
| Molecular Formula | C24H28BrNO5S |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | tert-butyl (2R,3R)-3-bromo-1-(4-methylphenyl)sulfonyl-4-oxo-2-propyl-2H-quinoline-3-carboxylate |
| SMILES | CCC[C@H]1N(S(=O)(=O)c2ccc(C)cc2)c2ccccc2C(=O)[C@@]1(Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28BrNO5S/c1-6-9-20-24(25,22(28)31-23(3,4)5)21(27)18-10-7-8-11-19(18)26(20)32(29,30)17-14-12-16(2)13-15-17/h7-8,10-15,20H,6,9H2,1-5H3/t20-,24-/m1/s1 |
| InChIKey | QQCYISBKCFREOK-HYBUGGRVSA-N |
| XLogP | 5.03 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|