C22H25NO5S — CID 102502061
tert-butyl 2-acetyl-1-(4-methylphenyl)sulfonyl-3H-indole-2-carboxylate (PubChem CID 102502061) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is tert-butyl 2-acetyl-1-(4-methylphenyl)sulfonyl-3H-indole-2-carboxylate.
| Compound Name | tert-butyl 2-acetyl-1-(4-methylphenyl)sulfonyl-3H-indole-2-carboxylate |
|---|---|
| PubChem CID | 102502061 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | tert-butyl 2-acetyl-1-(4-methylphenyl)sulfonyl-3H-indole-2-carboxylate |
| SMILES | CC(=O)C1(C(=O)OC(C)(C)C)Cc2ccccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H25NO5S/c1-15-10-12-18(13-11-15)29(26,27)23-19-9-7-6-8-17(19)14-22(23,16(2)24)20(25)28-21(3,4)5/h6-13H,14H2,1-5H3 |
| InChIKey | BNVJYLRBXLIMFY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|