C18H19NO2S — CID 10519271
1-(4-methylphenyl)sulfonyl-2-prop-1-en-2-yl-2,3-dihydroindole (PubChem CID 10519271) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-prop-1-en-2-yl-2,3-dihydroindole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-prop-1-en-2-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 10519271 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-prop-1-en-2-yl-2,3-dihydroindole |
| SMILES | C=C(C)C1Cc2ccccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO2S/c1-13(2)18-12-15-6-4-5-7-17(15)19(18)22(20,21)16-10-8-14(3)9-11-16/h4-11,18H,1,12H2,2-3H3 |
| InChIKey | ABBYKKRAEOZZOP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|