C17H16N2O5S — CID 70189180
(2R)-1-(4-acetamidophenyl)sulfonyl-2,3-dihydroindole-2-carboxylic acid (PubChem CID 70189180) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is (2R)-1-(4-acetamidophenyl)sulfonyl-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2R)-1-(4-acetamidophenyl)sulfonyl-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 70189180 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2R)-1-(4-acetamidophenyl)sulfonyl-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2c3ccccc3C[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c1-11(20)18-13-6-8-14(9-7-13)25(23,24)19-15-5-3-2-4-12(15)10-16(19)17(21)22/h2-9,16H,10H2,1H3,(H,18,20)(H,21,22)/t16-/m1/s1 |
| InChIKey | GOLMDYICQCEUEH-MRXNPFEDSA-N |
| XLogP | 1.85 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |