C19H15NO4S — CID 164640962
(2S)-1-naphthalen-2-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid (PubChem CID 164640962) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is (2S)-1-naphthalen-2-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-naphthalen-2-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 164640962 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (2S)-1-naphthalen-2-ylsulfonyl-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2ccccc2N1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15NO4S/c21-19(22)18-12-15-7-3-4-8-17(15)20(18)25(23,24)16-10-9-13-5-1-2-6-14(13)11-16/h1-11,18H,12H2,(H,21,22)/t18-/m0/s1 |
| InChIKey | ZVQVPTNOZVPJGZ-SFHVURJKSA-N |
| XLogP | 3.04 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |