C18H20N2O3S — CID 60606512
(2S)-1-(4-propylphenyl)sulfonyl-2,3-dihydroindole-2-carboxamide (PubChem CID 60606512) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (2S)-1-(4-propylphenyl)sulfonyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-(4-propylphenyl)sulfonyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 60606512 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2S)-1-(4-propylphenyl)sulfonyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CCCc1ccc(S(=O)(=O)N2c3ccccc3C[C@H]2C(N)=O)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-2-5-13-8-10-15(11-9-13)24(22,23)20-16-7-4-3-6-14(16)12-17(20)18(19)21/h3-4,6-11,17H,2,5,12H2,1H3,(H2,19,21)/t17-/m0/s1 |
| InChIKey | ZTFDLPLJBSFJSQ-KRWDZBQOSA-N |
| XLogP | 2.24 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |