C15H12Br2N2O3S — CID 60606488
(2S)-1-(2,5-dibromophenyl)sulfonyl-2,3-dihydroindole-2-carboxamide (PubChem CID 60606488) has the molecular formula C15H12Br2N2O3S and a molecular weight of 460.15 g/mol. Its IUPAC name is (2S)-1-(2,5-dibromophenyl)sulfonyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-(2,5-dibromophenyl)sulfonyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 60606488 |
| Molecular Formula | C15H12Br2N2O3S |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 457.89 |
| IUPAC Name | (2S)-1-(2,5-dibromophenyl)sulfonyl-2,3-dihydroindole-2-carboxamide |
| SMILES | NC(=O)[C@@H]1Cc2ccccc2N1S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H12Br2N2O3S/c16-10-5-6-11(17)14(8-10)23(21,22)19-12-4-2-1-3-9(12)7-13(19)15(18)20/h1-6,8,13H,7H2,(H2,18,20)/t13-/m0/s1 |
| InChIKey | WHZAUSYQKCEAHL-ZDUSSCGKSA-N |
| XLogP | 2.82 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |