C29H24F3N3O3S — CID 68884030
(2S)-1-[2-[(2-aminophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carboxamide (PubChem CID 68884030) has the molecular formula C29H24F3N3O3S and a molecular weight of 551.59 g/mol. Its IUPAC name is (2S)-1-[2-[(2-aminophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-[2-[(2-aminophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 68884030 |
| Molecular Formula | C29H24F3N3O3S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | (2S)-1-[2-[(2-aminophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carboxamide |
| SMILES | NC(=O)[C@@H]1Cc2ccccc2N1S(=O)(=O)c1ccc(-c2cccc(C(F)(F)F)c2)cc1Cc1ccccc1N |
| InChI | InChI=1S/C29H24F3N3O3S/c30-29(31,32)23-9-5-8-18(16-23)19-12-13-27(22(14-19)15-20-6-1-3-10-24(20)33)39(37,38)35-25-11-4-2-7-21(25)17-26(35)28(34)36/h1-14,16,26H,15,17,33H2,(H2,34,36)/t26-/m0/s1 |
| InChIKey | KBACNXNNWKQHHO-SANMLTNESA-N |
| XLogP | 5.15 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|