C34H31F3N2O6S — CID 69213088
methyl 2-[4-[2-[[(2S)-1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]phenyl]propanoate (PubChem CID 69213088) has the molecular formula C34H31F3N2O6S and a molecular weight of 652.69 g/mol. Its IUPAC name is methyl 2-[4-[2-[[(2S)-1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-[4-[2-[[(2S)-1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69213088 |
| Molecular Formula | C34H31F3N2O6S |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | methyl 2-[4-[2-[[(2S)-1-[4-[3-(trifluoromethyl)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(C)c1ccc(OCCNC(=O)[C@@H]2Cc3ccccc3N2S(=O)(=O)c2ccc(-c3cccc(C(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C34H31F3N2O6S/c1-22(33(41)44-2)23-10-14-28(15-11-23)45-19-18-38-32(40)31-21-26-6-3-4-9-30(26)39(31)46(42,43)29-16-12-24(13-17-29)25-7-5-8-27(20-25)34(35,36)37/h3-17,20,22,31H,18-19,21H2,1-2H3,(H,38,40)/t22?,31-/m0/s1 |
| InChIKey | HJIXYWZZADMDOO-NMBPHSMGSA-N |
| XLogP | 5.96 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|