C32H27F3N2O7S — CID 69208567
2-[4-[2-[[(2S)-1-[4-[3-(trifluoromethoxy)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]phenyl]acetic acid (PubChem CID 69208567) has the molecular formula C32H27F3N2O7S and a molecular weight of 640.64 g/mol. Its IUPAC name is 2-[4-[2-[[(2S)-1-[4-[3-(trifluoromethoxy)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[[(2S)-1-[4-[3-(trifluoromethoxy)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 69208567 |
| Molecular Formula | C32H27F3N2O7S |
| Molecular Weight | 640.64 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | 2-[4-[2-[[(2S)-1-[4-[3-(trifluoromethoxy)phenyl]phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(OCCNC(=O)[C@@H]2Cc3ccccc3N2S(=O)(=O)c2ccc(-c3cccc(OC(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C32H27F3N2O7S/c33-32(34,35)44-26-6-3-5-23(19-26)22-10-14-27(15-11-22)45(41,42)37-28-7-2-1-4-24(28)20-29(37)31(40)36-16-17-43-25-12-8-21(9-13-25)18-30(38)39/h1-15,19,29H,16-18,20H2,(H,36,40)(H,38,39)/t29-/m0/s1 |
| InChIKey | NNGYFIBCEAMZES-LJAQVGFWSA-N |
| XLogP | 5.19 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|