C31H26F2N2O6S — CID 69208607
2-fluoro-4-[2-[[(2S)-1-[4-(4-fluoro-2-methylphenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]benzoic acid (PubChem CID 69208607) has the molecular formula C31H26F2N2O6S and a molecular weight of 592.62 g/mol. Its IUPAC name is 2-fluoro-4-[2-[[(2S)-1-[4-(4-fluoro-2-methylphenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]benzoic acid.
| Compound Name | 2-fluoro-4-[2-[[(2S)-1-[4-(4-fluoro-2-methylphenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 69208607 |
| Molecular Formula | C31H26F2N2O6S |
| Molecular Weight | 592.62 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 2-fluoro-4-[2-[[(2S)-1-[4-(4-fluoro-2-methylphenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]benzoic acid |
| SMILES | Cc1cc(F)ccc1-c1ccc(S(=O)(=O)N2c3ccccc3C[C@H]2C(=O)NCCOc2ccc(C(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C31H26F2N2O6S/c1-19-16-22(32)8-12-25(19)20-6-10-24(11-7-20)42(39,40)35-28-5-3-2-4-21(28)17-29(35)30(36)34-14-15-41-23-9-13-26(31(37)38)27(33)18-23/h2-13,16,18,29H,14-15,17H2,1H3,(H,34,36)(H,37,38)/t29-/m0/s1 |
| InChIKey | DBCSSMKWWTXNHT-LJAQVGFWSA-N |
| XLogP | 4.95 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|