C32H26F4N2O6S — CID 69213998
methyl 4-[2-[[(2S)-1-[4-(4-fluorophenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]-2-(trifluoromethyl)benzoate (PubChem CID 69213998) has the molecular formula C32H26F4N2O6S and a molecular weight of 642.63 g/mol. Its IUPAC name is methyl 4-[2-[[(2S)-1-[4-(4-fluorophenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]-2-(trifluoromethyl)benzoate.
| Compound Name | methyl 4-[2-[[(2S)-1-[4-(4-fluorophenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 69213998 |
| Molecular Formula | C32H26F4N2O6S |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 642.14 |
| IUPAC Name | methyl 4-[2-[[(2S)-1-[4-(4-fluorophenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]-2-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(OCCNC(=O)[C@@H]2Cc3ccccc3N2S(=O)(=O)c2ccc(-c3ccc(F)cc3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C32H26F4N2O6S/c1-43-31(40)26-15-12-24(19-27(26)32(34,35)36)44-17-16-37-30(39)29-18-22-4-2-3-5-28(22)38(29)45(41,42)25-13-8-21(9-14-25)20-6-10-23(33)11-7-20/h2-15,19,29H,16-18H2,1H3,(H,37,39)/t29-/m0/s1 |
| InChIKey | FSZOZIMMFDCQEL-LJAQVGFWSA-N |
| XLogP | 5.61 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|