C30H23F3N2O6S — CID 69210803
4-[2-[[(2S)-1-[4-(2,4-difluorophenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]-3-fluorobenzoic acid (PubChem CID 69210803) has the molecular formula C30H23F3N2O6S and a molecular weight of 596.58 g/mol. Its IUPAC name is 4-[2-[[(2S)-1-[4-(2,4-difluorophenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]-3-fluorobenzoic acid.
| Compound Name | 4-[2-[[(2S)-1-[4-(2,4-difluorophenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 69210803 |
| Molecular Formula | C30H23F3N2O6S |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | 4-[2-[[(2S)-1-[4-(2,4-difluorophenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(OCCNC(=O)[C@@H]2Cc3ccccc3N2S(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c(F)c1 |
| InChI | InChI=1S/C30H23F3N2O6S/c31-21-8-11-23(24(32)17-21)18-5-9-22(10-6-18)42(39,40)35-26-4-2-1-3-19(26)16-27(35)29(36)34-13-14-41-28-12-7-20(30(37)38)15-25(28)33/h1-12,15,17,27H,13-14,16H2,(H,34,36)(H,37,38)/t27-/m0/s1 |
| InChIKey | XDGVKVBSLACJDB-MHZLTWQESA-N |
| XLogP | 4.78 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|