C32H28F2N2O7S — CID 69214769
methyl 2-fluoro-4-[2-[[(2S)-1-[4-(4-fluoro-2-methoxyphenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]benzoate (PubChem CID 69214769) has the molecular formula C32H28F2N2O7S and a molecular weight of 622.65 g/mol. Its IUPAC name is methyl 2-fluoro-4-[2-[[(2S)-1-[4-(4-fluoro-2-methoxyphenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]benzoate.
| Compound Name | methyl 2-fluoro-4-[2-[[(2S)-1-[4-(4-fluoro-2-methoxyphenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]benzoate |
|---|---|
| PubChem CID | 69214769 |
| Molecular Formula | C32H28F2N2O7S |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | methyl 2-fluoro-4-[2-[[(2S)-1-[4-(4-fluoro-2-methoxyphenyl)phenyl]sulfonyl-2,3-dihydroindole-2-carbonyl]amino]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCNC(=O)[C@@H]2Cc3ccccc3N2S(=O)(=O)c2ccc(-c3ccc(F)cc3OC)cc2)cc1F |
| InChI | InChI=1S/C32H28F2N2O7S/c1-41-30-18-22(33)9-13-25(30)20-7-11-24(12-8-20)44(39,40)36-28-6-4-3-5-21(28)17-29(36)31(37)35-15-16-43-23-10-14-26(27(34)19-23)32(38)42-2/h3-14,18-19,29H,15-17H2,1-2H3,(H,35,37)/t29-/m0/s1 |
| InChIKey | PDWCEGFHMZSYGB-LJAQVGFWSA-N |
| XLogP | 4.74 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|