C22H20N2O3SY-2 — CID 59725843
carbanide;[1-(4-phenylphenyl)sulfonyl-2,3-dihydroindole-2-carbonyl]azanide;yttrium (PubChem CID 59725843) has the molecular formula C22H20N2O3SY-2 and a molecular weight of 481.39 g/mol. Its IUPAC name is carbanide;[1-(4-phenylphenyl)sulfonyl-2,3-dihydroindole-2-carbonyl]azanide;yttrium.
| Compound Name | carbanide;[1-(4-phenylphenyl)sulfonyl-2,3-dihydroindole-2-carbonyl]azanide;yttrium |
|---|---|
| PubChem CID | 59725843 |
| Molecular Formula | C22H20N2O3SY-2 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | carbanide;[1-(4-phenylphenyl)sulfonyl-2,3-dihydroindole-2-carbonyl]azanide;yttrium |
| SMILES | [CH3-].[NH-]C(=O)C1Cc2ccccc2N1S(=O)(=O)c1ccc(-c2ccccc2)cc1.[Y] |
| InChI | InChI=1S/C21H18N2O3S.CH3.Y/c22-21(24)20-14-17-8-4-5-9-19(17)23(20)27(25,26)18-12-10-16(11-13-18)15-6-2-1-3-7-15;;/h1-13,20H,14H2,(H2,22,24);1H3;/q;-1;/p-1 |
| InChIKey | XXKLQGJESXIANN-UHFFFAOYSA-M |
| XLogP | 4.50 |
| TPSA | 78.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|