C25H31NO2S — CID 10982458
2-[(E)-3-cyclohexylprop-1-enyl]-2-methyl-1-(4-methylphenyl)sulfonyl-3H-indole (PubChem CID 10982458) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is 2-[(E)-3-cyclohexylprop-1-enyl]-2-methyl-1-(4-methylphenyl)sulfonyl-3H-indole.
| Compound Name | 2-[(E)-3-cyclohexylprop-1-enyl]-2-methyl-1-(4-methylphenyl)sulfonyl-3H-indole |
|---|---|
| PubChem CID | 10982458 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-[(E)-3-cyclohexylprop-1-enyl]-2-methyl-1-(4-methylphenyl)sulfonyl-3H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3CC2(C)/C=C/CC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H31NO2S/c1-20-14-16-23(17-15-20)29(27,28)26-24-13-7-6-12-22(24)19-25(26,2)18-8-11-21-9-4-3-5-10-21/h6-8,12-18,21H,3-5,9-11,19H2,1-2H3/b18-8+ |
| InChIKey | YBQCKXJOTYJANE-QGMBQPNBSA-N |
| XLogP | 6.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|