C20H23NO2S2 — CID 44597020
(5aR,10aR)-11-(4-methylphenyl)sulfonyl-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazine (PubChem CID 44597020) has the molecular formula C20H23NO2S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is (5aR,10aR)-11-(4-methylphenyl)sulfonyl-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazine.
| Compound Name | (5aR,10aR)-11-(4-methylphenyl)sulfonyl-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazine |
|---|---|
| PubChem CID | 44597020 |
| Molecular Formula | C20H23NO2S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (5aR,10aR)-11-(4-methylphenyl)sulfonyl-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazine |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3S[C@@H]3CCCCC[C@H]32)cc1 |
| InChI | InChI=1S/C20H23NO2S2/c1-15-11-13-16(14-12-15)25(22,23)21-17-7-3-2-4-9-19(17)24-20-10-6-5-8-18(20)21/h5-6,8,10-14,17,19H,2-4,7,9H2,1H3/t17-,19-/m1/s1 |
| InChIKey | GUXLPEDMFWFIOC-IEBWSBKVSA-N |
| XLogP | 5.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |