C19H22N2O2S2 — CID 146162114
3-methyl-4-(4-methylphenyl)sulfonyl-N-propan-2-yl-3H-1,4-benzothiazin-2-imine (PubChem CID 146162114) has the molecular formula C19H22N2O2S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 3-methyl-4-(4-methylphenyl)sulfonyl-N-propan-2-yl-3H-1,4-benzothiazin-2-imine.
| Compound Name | 3-methyl-4-(4-methylphenyl)sulfonyl-N-propan-2-yl-3H-1,4-benzothiazin-2-imine |
|---|---|
| PubChem CID | 146162114 |
| Molecular Formula | C19H22N2O2S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3-methyl-4-(4-methylphenyl)sulfonyl-N-propan-2-yl-3H-1,4-benzothiazin-2-imine |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3S/C(=N\C(C)C)C2C)cc1 |
| InChI | InChI=1S/C19H22N2O2S2/c1-13(2)20-19-15(4)21(17-7-5-6-8-18(17)24-19)25(22,23)16-11-9-14(3)10-12-16/h5-13,15H,1-4H3/b20-19- |
| InChIKey | QTDZFOLIOPENCA-VXPUYCOJSA-N |
| XLogP | 4.49 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|